About 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one
3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one (PubChem CID 131071380) has the molecular formula C9H16ClNOS
and a molecular weight of 221.75 g/mol. Its IUPAC name is 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one |
| PubChem CID | 131071380 |
| Molecular Formula | C9H16ClNOS |
| Molecular Weight | 221.75 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one |
| SMILES | CC1CSCCN(C(=O)CCCl)C1 |
| InChI | InChI=1S/C9H16ClNOS/c1-8-6-11(4-5-13-7-8)9(12)2-3-10/h8H,2-7H2,1H3 |
| InChIKey | CQXWGMWYVXYTKZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one?
The IUPAC name of 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one (CID 131071380) is 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one.
What is the SMILES notation for 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one?
The canonical SMILES for 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one is CC1CSCCN(C(=O)CCCl)C1.
What is the InChIKey of 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one?
The InChIKey is CQXWGMWYVXYTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNOS/c1-8-6-11(4-5-13-7-8)9(12)2-3-10/h8H,2-7H2,1H3.
What are the key properties of 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one?
3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one has a molecular weight of 221.75 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(6-methyl-1,4-thiazepan-4-yl)propan-1-one is sourced from PubChem (CID 131071380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).