C8H16N2OS — CID 130670870
N,6-dimethyl-1,4-thiazepane-4-carboxamide (PubChem CID 130670870) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is N,6-dimethyl-1,4-thiazepane-4-carboxamide.
| Compound Name | N,6-dimethyl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 130670870 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | N,6-dimethyl-1,4-thiazepane-4-carboxamide |
| SMILES | CNC(=O)N1CCSCC(C)C1 |
| InChI | InChI=1S/C8H16N2OS/c1-7-5-10(8(11)9-2)3-4-12-6-7/h7H,3-6H2,1-2H3,(H,9,11) |
| InChIKey | CCNPPFGHEKQUJF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |