C11H19NO — CID 131102209
1-(3,4-dimethylpyrrolidin-1-yl)-3-methylbut-3-en-1-one (PubChem CID 131102209) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(3,4-dimethylpyrrolidin-1-yl)-3-methylbut-3-en-1-one.
| Compound Name | 1-(3,4-dimethylpyrrolidin-1-yl)-3-methylbut-3-en-1-one |
|---|---|
| PubChem CID | 131102209 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(3,4-dimethylpyrrolidin-1-yl)-3-methylbut-3-en-1-one |
| SMILES | C=C(C)CC(=O)N1CC(C)C(C)C1 |
| InChI | InChI=1S/C11H19NO/c1-8(2)5-11(13)12-6-9(3)10(4)7-12/h9-10H,1,5-7H2,2-4H3 |
| InChIKey | RAWKGFXOCDJWKW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|