C12H26N2O3 — CID 113317455
1-(2,2-dimethylmorpholin-4-yl)-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 113317455) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(2,2-dimethylmorpholin-4-yl)-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(2,2-dimethylmorpholin-4-yl)-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 113317455 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 1-(2,2-dimethylmorpholin-4-yl)-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)CN1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H26N2O3/c1-12(2)10-14(5-7-17-12)9-11(15)8-13-4-6-16-3/h11,13,15H,4-10H2,1-3H3 |
| InChIKey | OEKSTLSFZAQXFS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|