C16H25NO3 — CID 60761061
1-(2,2-dimethylmorpholin-4-yl)-3-phenylmethoxypropan-2-ol (PubChem CID 60761061) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(2,2-dimethylmorpholin-4-yl)-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-(2,2-dimethylmorpholin-4-yl)-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 60761061 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-(2,2-dimethylmorpholin-4-yl)-3-phenylmethoxypropan-2-ol |
| SMILES | CC1(C)CN(CC(O)COCc2ccccc2)CCO1 |
| InChI | InChI=1S/C16H25NO3/c1-16(2)13-17(8-9-20-16)10-15(18)12-19-11-14-6-4-3-5-7-14/h3-7,15,18H,8-13H2,1-2H3 |
| InChIKey | LSRQXCNLRODBFR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |