C12H25NO3 — CID 116525065
1-(5,5-dimethyloxolan-2-yl)-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 116525065) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(5,5-dimethyloxolan-2-yl)-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(5,5-dimethyloxolan-2-yl)-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 116525065 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(5,5-dimethyloxolan-2-yl)-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H25NO3/c1-12(2)5-4-11(16-12)8-10(14)9-13-6-7-15-3/h10-11,13-14H,4-9H2,1-3H3 |
| InChIKey | BFTBQSMWLZIPBJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|