C14H28N4O3 — CID 78912437
2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 78912437) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 78912437 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)CNCCOC)CC1 |
| InChI | InChI=1S/C14H28N4O3/c1-3-4-16-13(19)12-17-6-8-18(9-7-17)14(20)11-15-5-10-21-2/h15H,3-12H2,1-2H3,(H,16,19) |
| InChIKey | SKJXCHYFNCKXCH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|