C12H24O4 — CID 103176134
3-[2-(3-methoxypropoxy)ethoxy]-2,2-dimethylcyclobutan-1-ol (PubChem CID 103176134) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-[2-(3-methoxypropoxy)ethoxy]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[2-(3-methoxypropoxy)ethoxy]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103176134 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 3-[2-(3-methoxypropoxy)ethoxy]-2,2-dimethylcyclobutan-1-ol |
| SMILES | COCCCOCCOC1CC(O)C1(C)C |
| InChI | InChI=1S/C12H24O4/c1-12(2)10(13)9-11(12)16-8-7-15-6-4-5-14-3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | NPNDPSHBYSXRFT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|