C15H31NO3 — CID 103408104
3-[3-(2-methoxyethoxy)propoxy]-2,2-dimethyl-N-propylcyclobutan-1-amine (PubChem CID 103408104) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)propoxy]-2,2-dimethyl-N-propylcyclobutan-1-amine.
| Compound Name | 3-[3-(2-methoxyethoxy)propoxy]-2,2-dimethyl-N-propylcyclobutan-1-amine |
|---|---|
| PubChem CID | 103408104 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)propoxy]-2,2-dimethyl-N-propylcyclobutan-1-amine |
| SMILES | CCCNC1CC(OCCCOCCOC)C1(C)C |
| InChI | InChI=1S/C15H31NO3/c1-5-7-16-13-12-14(15(13,2)3)19-9-6-8-18-11-10-17-4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | JFCUVXPUDFEECC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|