C16H33NO3 — CID 64853122
N-[3-(2-methoxyethoxy)propyl]-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine (PubChem CID 64853122) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine |
|---|---|
| PubChem CID | 64853122 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine |
| SMILES | COCCOCCCNC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C16H33NO3/c1-13(2)12-20-15-11-14(16(15,3)4)17-7-6-8-19-10-9-18-5/h13-15,17H,6-12H2,1-5H3 |
| InChIKey | JKHLBZYTWWYTHR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|