C15H21BrO2 — CID 82825677
3-[(4-bromophenyl)methoxy]-2,2-diethylcyclobutan-1-ol (PubChem CID 82825677) has the molecular formula C15H21BrO2 and a molecular weight of 313.23 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methoxy]-2,2-diethylcyclobutan-1-ol.
| Compound Name | 3-[(4-bromophenyl)methoxy]-2,2-diethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 82825677 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-[(4-bromophenyl)methoxy]-2,2-diethylcyclobutan-1-ol |
| SMILES | CCC1(CC)C(O)CC1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrO2/c1-3-15(4-2)13(17)9-14(15)18-10-11-5-7-12(16)8-6-11/h5-8,13-14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | HVXCQWKHSSOXQC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |