C11H21N3O — CID 103741947
1-cyclopropyl-2-(3-methoxy-2,2-dimethylcyclobutyl)guanidine (PubChem CID 103741947) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3-methoxy-2,2-dimethylcyclobutyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(3-methoxy-2,2-dimethylcyclobutyl)guanidine |
|---|---|
| PubChem CID | 103741947 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-cyclopropyl-2-(3-methoxy-2,2-dimethylcyclobutyl)guanidine |
| SMILES | COC1CC(/N=C(\N)NC2CC2)C1(C)C |
| InChI | InChI=1S/C11H21N3O/c1-11(2)8(6-9(11)15-3)14-10(12)13-7-4-5-7/h7-9H,4-6H2,1-3H3,(H3,12,13,14) |
| InChIKey | TYKSGJZQGVUKEK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|