C7H16N2 — CID 99867045
trans-(1S,3S)-2,2-dimethylcyclopentane-1,3-diamine (PubChem CID 99867045) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is trans-(1S,3S)-2,2-dimethylcyclopentane-1,3-diamine.
| Compound Name | trans-(1S,3S)-2,2-dimethylcyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 99867045 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | trans-(1S,3S)-2,2-dimethylcyclopentane-1,3-diamine |
| SMILES | CC1(C)[C@@H](N)CC[C@@H]1N |
| InChI | InChI=1S/C7H16N2/c1-7(2)5(8)3-4-6(7)9/h5-6H,3-4,8-9H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | LMWUVNSDFYGNLV-WDSKDSINSA-N |
| XLogP | 0.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |