C8H17NS — CID 142226260
3,3-dimethylthiepan-4-amine (PubChem CID 142226260) has the molecular formula C8H17NS and a molecular weight of 159.30 g/mol. Its IUPAC name is 3,3-dimethylthiepan-4-amine.
| Compound Name | 3,3-dimethylthiepan-4-amine |
|---|---|
| PubChem CID | 142226260 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 3,3-dimethylthiepan-4-amine |
| SMILES | CC1(C)CSCCCC1N |
| InChI | InChI=1S/C8H17NS/c1-8(2)6-10-5-3-4-7(8)9/h7H,3-6,9H2,1-2H3 |
| InChIKey | GWBWLXBTBJXLTK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |