C20H28O5 — CID 146578213
(1S,4S,5R,6S,10R,11R,15R)-4,5,6-trihydroxy-3,7,12,12,15-pentamethyl-8-oxapentacyclo[8.5.1.01,5.07,9.011,13]hexadec-2-en-16-one (PubChem CID 146578213) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,4S,5R,6S,10R,11R,15R)-4,5,6-trihydroxy-3,7,12,12,15-pentamethyl-8-oxapentacyclo[8.5.1.01,5.07,9.011,13]hexadec-2-en-16-one.
| Compound Name | (1S,4S,5R,6S,10R,11R,15R)-4,5,6-trihydroxy-3,7,12,12,15-pentamethyl-8-oxapentacyclo[8.5.1.01,5.07,9.011,13]hexadec-2-en-16-one |
|---|---|
| PubChem CID | 146578213 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,4S,5R,6S,10R,11R,15R)-4,5,6-trihydroxy-3,7,12,12,15-pentamethyl-8-oxapentacyclo[8.5.1.01,5.07,9.011,13]hexadec-2-en-16-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C4OC4(C)[C@@H](O)[C@]2(O)[C@H]1O)[C@H]1C(C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C20H28O5/c1-8-7-19-9(2)6-10-12(17(10,3)4)11(14(19)22)15-18(5,25-15)16(23)20(19,24)13(8)21/h7,9-13,15-16,21,23-24H,6H2,1-5H3/t9-,10?,11+,12-,13+,15?,16-,18?,19+,20-/m1/s1 |
| InChIKey | IQTYIGPUUJIEIG-OEXMPETOSA-N |
| XLogP | 1.05 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|