C26H38O5 — CID 56645794
(4S,5R,6R,14R,16R,18R)-8-tert-butyl-4,5-dihydroxy-3,8,15,15,18-pentamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one (PubChem CID 56645794) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (4S,5R,6R,14R,16R,18R)-8-tert-butyl-4,5-dihydroxy-3,8,15,15,18-pentamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one.
| Compound Name | (4S,5R,6R,14R,16R,18R)-8-tert-butyl-4,5-dihydroxy-3,8,15,15,18-pentamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
|---|---|
| PubChem CID | 56645794 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (4S,5R,6R,14R,16R,18R)-8-tert-butyl-4,5-dihydroxy-3,8,15,15,18-pentamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
| SMILES | CC1=CC23C(=O)C(C=C4COC(C)(C(C)(C)C)O[C@H]4[C@]2(O)[C@H]1O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C26H38O5/c1-13-11-25-14(2)9-17-18(23(17,6)7)16(20(25)28)10-15-12-30-24(8,22(3,4)5)31-21(15)26(25,29)19(13)27/h10-11,14,16-19,21,27,29H,9,12H2,1-8H3/t14-,16?,17-,18+,19+,21-,24?,25?,26-/m1/s1 |
| InChIKey | HHFJXZNOFVRZPQ-KUSAGFOISA-N |
| XLogP | 3.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|