C30H38O5 — CID 56645989
(4S,5R,6R,14R,16R,18R)-4,5-dihydroxy-3,15,15,18-tetramethyl-8-(2,4,6-trimethylphenyl)-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one (PubChem CID 56645989) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is (4S,5R,6R,14R,16R,18R)-4,5-dihydroxy-3,15,15,18-tetramethyl-8-(2,4,6-trimethylphenyl)-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one.
| Compound Name | (4S,5R,6R,14R,16R,18R)-4,5-dihydroxy-3,15,15,18-tetramethyl-8-(2,4,6-trimethylphenyl)-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
|---|---|
| PubChem CID | 56645989 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (4S,5R,6R,14R,16R,18R)-4,5-dihydroxy-3,15,15,18-tetramethyl-8-(2,4,6-trimethylphenyl)-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-19-one |
| SMILES | CC1=CC23C(=O)C(C=C4COC(c5c(C)cc(C)cc5C)O[C@H]4[C@]2(O)[C@H]1O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H38O5/c1-14-8-15(2)22(16(3)9-14)27-34-13-19-11-20-23-21(28(23,6)7)10-18(5)29(25(20)32)12-17(4)24(31)30(29,33)26(19)35-27/h8-9,11-12,18,20-21,23-24,26-27,31,33H,10,13H2,1-7H3/t18-,20?,21-,23+,24+,26-,27?,29?,30-/m1/s1 |
| InChIKey | AUANIEIJDLUEAA-WETGSGBESA-N |
| XLogP | 4.50 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|