C6H8 — CID 86129037
1-methyltricyclo[2.1.0.02,5]pentane (PubChem CID 86129037) has the molecular formula C6H8 and a molecular weight of 80.13 g/mol. Its IUPAC name is 1-methyltricyclo[2.1.0.02,5]pentane.
| Compound Name | 1-methyltricyclo[2.1.0.02,5]pentane |
|---|---|
| PubChem CID | 86129037 |
| Molecular Formula | C6H8 |
| Molecular Weight | 80.13 g/mol |
| Exact Mass | 80.06 |
| IUPAC Name | 1-methyltricyclo[2.1.0.02,5]pentane |
| SMILES | CC12C3CC1C32 |
| InChI | InChI=1S/C6H8/c1-6-3-2-4(6)5(3)6/h3-5H,2H2,1H3 |
| InChIKey | JOUZDRZIABHFNR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 80.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |