C11H14 — CID 123294037
9-methylpentacyclo[4.4.0.01,5.02,9.04,8]decane (PubChem CID 123294037) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 9-methylpentacyclo[4.4.0.01,5.02,9.04,8]decane.
| Compound Name | 9-methylpentacyclo[4.4.0.01,5.02,9.04,8]decane |
|---|---|
| PubChem CID | 123294037 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 9-methylpentacyclo[4.4.0.01,5.02,9.04,8]decane |
| SMILES | CC12CC34C5CC1C(CC23)C54 |
| InChI | InChI=1S/C11H14/c1-10-4-11-7-3-6(10)5(9(7)11)2-8(10)11/h5-9H,2-4H2,1H3 |
| InChIKey | WDWXGAXNOZGGKT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |