About 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane]
2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane] (PubChem CID 163933579) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane].
Analyze 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane]?
The IUPAC name of 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane] (CID 163933579) is 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane].
What is the SMILES notation for 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane]?
The canonical SMILES for 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane] is CCC1CC12C1CC3CC3C12.
What is the InChIKey of 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane]?
The InChIKey is RKUHLLPGSFIKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-2-7-5-11(7)9-4-6-3-8(6)10(9)11/h6-10H,2-5H2,1H3.
What are the key properties of 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane]?
2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane] has a molecular weight of 148.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylspiro[cyclopropane-1,3'-tricyclo[4.1.0.02,4]heptane] is sourced from PubChem (CID 163933579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).