About N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine
N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine (PubChem CID 3720431) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine.
Molecular Properties
| Compound Name | N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine |
| PubChem CID | 3720431 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine |
| SMILES | CCNC1C2CC3C1C3(CC)C2 |
| InChI | InChI=1S/C11H19N/c1-3-11-6-7-5-8(11)9(11)10(7)12-4-2/h7-10,12H,3-6H2,1-2H3 |
| InChIKey | JXABZUKPGATLHK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine?
The IUPAC name of N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine (CID 3720431) is N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine.
What is the SMILES notation for N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine?
The canonical SMILES for N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine is CCNC1C2CC3C1C3(CC)C2.
What is the InChIKey of N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine?
The InChIKey is JXABZUKPGATLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-3-11-6-7-5-8(11)9(11)10(7)12-4-2/h7-10,12H,3-6H2,1-2H3.
What are the key properties of N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine?
N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine has a molecular weight of 165.28 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-diethyltricyclo[2.2.1.02,6]heptan-3-amine is sourced from PubChem (CID 3720431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).