C14H26 — CID 91055723
2-ethyl-4,7,9-trimethylspiro[2.6]nonane (PubChem CID 91055723) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 2-ethyl-4,7,9-trimethylspiro[2.6]nonane.
| Compound Name | 2-ethyl-4,7,9-trimethylspiro[2.6]nonane |
|---|---|
| PubChem CID | 91055723 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 2-ethyl-4,7,9-trimethylspiro[2.6]nonane |
| SMILES | CCC1CC12C(C)CCC(C)CC2C |
| InChI | InChI=1S/C14H26/c1-5-13-9-14(13)11(3)7-6-10(2)8-12(14)4/h10-13H,5-9H2,1-4H3 |
| InChIKey | SLGMXOLWTPQURG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |