C11H22 — CID 123642131
1-ethyl-1,2,5-trimethylcyclohexane (PubChem CID 123642131) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is 1-ethyl-1,2,5-trimethylcyclohexane.
| Compound Name | 1-ethyl-1,2,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 123642131 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 1-ethyl-1,2,5-trimethylcyclohexane |
| SMILES | CCC1(C)CC(C)CCC1C |
| InChI | InChI=1S/C11H22/c1-5-11(4)8-9(2)6-7-10(11)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | YHXZHKLOPNPLNV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |