C15H28N2 — CID 163983597
(1S,3S,5S,10S)-3-ethyl-5,10-dimethyltricyclo[7.1.1.02,6]undecane-2,5-diamine (PubChem CID 163983597) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (1S,3S,5S,10S)-3-ethyl-5,10-dimethyltricyclo[7.1.1.02,6]undecane-2,5-diamine.
| Compound Name | (1S,3S,5S,10S)-3-ethyl-5,10-dimethyltricyclo[7.1.1.02,6]undecane-2,5-diamine |
|---|---|
| PubChem CID | 163983597 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (1S,3S,5S,10S)-3-ethyl-5,10-dimethyltricyclo[7.1.1.02,6]undecane-2,5-diamine |
| SMILES | CC[C@H]1C[C@](C)(N)C2CCC3C[C@@H]([C@H]3C)C21N |
| InChI | InChI=1S/C15H28N2/c1-4-11-8-14(3,16)13-6-5-10-7-12(9(10)2)15(11,13)17/h9-13H,4-8,16-17H2,1-3H3/t9-,10?,11-,12-,13?,14-,15?/m0/s1 |
| InChIKey | TUJSVHJSKXEEGW-YKFQJFHUSA-N |
| XLogP | 2.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |