C12H25N — CID 91301916
(1S)-2-ethyl-1,3,4,5-tetramethylcyclohexan-1-amine (PubChem CID 91301916) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (1S)-2-ethyl-1,3,4,5-tetramethylcyclohexan-1-amine.
| Compound Name | (1S)-2-ethyl-1,3,4,5-tetramethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 91301916 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (1S)-2-ethyl-1,3,4,5-tetramethylcyclohexan-1-amine |
| SMILES | CCC1C(C)C(C)C(C)C[C@]1(C)N |
| InChI | InChI=1S/C12H25N/c1-6-11-10(4)9(3)8(2)7-12(11,5)13/h8-11H,6-7,13H2,1-5H3/t8?,9?,10?,11?,12-/m0/s1 |
| InChIKey | LRIOAJYXZZEHFT-SXVYVOEYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |