About 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane
3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane (PubChem CID 123212061) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane.
Analyze 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane?
The IUPAC name of 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane (CID 123212061) is 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane.
What is the SMILES notation for 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane?
The canonical SMILES for 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane is CCC1C(C)C2CC(C)CC(CC2C)C1(C)C.
What is the InChIKey of 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane?
The InChIKey is DKQGTZHIIAXBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32/c1-7-16-13(4)15-9-11(2)8-14(10-12(15)3)17(16,5)6/h11-16H,7-10H2,1-6H3.
What are the key properties of 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane?
3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane has a molecular weight of 236.44 g/mol, XLogP of 5.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,2,4,7,10-pentamethylbicyclo[3.3.2]decane is sourced from PubChem (CID 123212061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).