C11H17Br — CID 134888977
(1S,3S,5R,7R)-8-bromo-1,4,4-trimethyltricyclo[5.1.0.03,5]octane (PubChem CID 134888977) has the molecular formula C11H17Br and a molecular weight of 229.16 g/mol. Its IUPAC name is (1S,3S,5R,7R)-8-bromo-1,4,4-trimethyltricyclo[5.1.0.03,5]octane.
| Compound Name | (1S,3S,5R,7R)-8-bromo-1,4,4-trimethyltricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 134888977 |
| Molecular Formula | C11H17Br |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (1S,3S,5R,7R)-8-bromo-1,4,4-trimethyltricyclo[5.1.0.03,5]octane |
| SMILES | CC1(C)[C@@H]2C[C@H]3C(Br)[C@@]3(C)C[C@@H]21 |
| InChI | InChI=1S/C11H17Br/c1-10(2)6-4-7-9(12)11(7,3)5-8(6)10/h6-9H,4-5H2,1-3H3/t6-,7+,8+,9?,11+/m1/s1 |
| InChIKey | RJONBIBNKKFXPV-GRIIZMAOSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|