C7H12BrN — CID 124710644
(1R,6S,7S)-7-bromo-6-methyl-3-azabicyclo[4.1.0]heptane (PubChem CID 124710644) has the molecular formula C7H12BrN and a molecular weight of 190.08 g/mol. Its IUPAC name is (1R,6S,7S)-7-bromo-6-methyl-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,6S,7S)-7-bromo-6-methyl-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 124710644 |
| Molecular Formula | C7H12BrN |
| Molecular Weight | 190.08 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | (1R,6S,7S)-7-bromo-6-methyl-3-azabicyclo[4.1.0]heptane |
| SMILES | C[C@]12CCNC[C@@H]1[C@@H]2Br |
| InChI | InChI=1S/C7H12BrN/c1-7-2-3-9-4-5(7)6(7)8/h5-6,9H,2-4H2,1H3/t5-,6+,7+/m1/s1 |
| InChIKey | XSSHURPADRDLAP-VQVTYTSYSA-N |
| XLogP | 1.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.08 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|