C12H23N — CID 140985384
4a,7,8-trimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 140985384) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4a,7,8-trimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 4a,7,8-trimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 140985384 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4a,7,8-trimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | CC1CCC2(C)CCNCC2C1C |
| InChI | InChI=1S/C12H23N/c1-9-4-5-12(3)6-7-13-8-11(12)10(9)2/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | XGWWBAUCJZQYHA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |