C12H19IO2 — CID 102375217
(4-iodo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) acetate (PubChem CID 102375217) has the molecular formula C12H19IO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is (4-iodo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) acetate.
| Compound Name | (4-iodo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) acetate |
|---|---|
| PubChem CID | 102375217 |
| Molecular Formula | C12H19IO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (4-iodo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) acetate |
| SMILES | CC(=O)OC1(C)CC2C(CC1I)C2(C)C |
| InChI | InChI=1S/C12H19IO2/c1-7(14)15-12(4)6-9-8(5-10(12)13)11(9,2)3/h8-10H,5-6H2,1-4H3 |
| InChIKey | PRFSJIKDZUCZPY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|