C28H50 — CID 22894527
2,3,5,5,8,8,9,9,12,12-decamethyl-1,2,3,4,4a,5a,6,6a,7,10,10a,11,11a,12a-tetradecahydrotetracene (PubChem CID 22894527) has the molecular formula C28H50 and a molecular weight of 386.71 g/mol. Its IUPAC name is 2,3,5,5,8,8,9,9,12,12-decamethyl-1,2,3,4,4a,5a,6,6a,7,10,10a,11,11a,12a-tetradecahydrotetracene.
| Compound Name | 2,3,5,5,8,8,9,9,12,12-decamethyl-1,2,3,4,4a,5a,6,6a,7,10,10a,11,11a,12a-tetradecahydrotetracene |
|---|---|
| PubChem CID | 22894527 |
| Molecular Formula | C28H50 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | 2,3,5,5,8,8,9,9,12,12-decamethyl-1,2,3,4,4a,5a,6,6a,7,10,10a,11,11a,12a-tetradecahydrotetracene |
| SMILES | CC1CC2C(CC1C)C(C)(C)C1CC3CC(C)(C)C(C)(C)CC3CC1C2(C)C |
| InChI | InChI=1S/C28H50/c1-17-11-21-22(12-18(17)2)28(9,10)24-14-20-16-26(5,6)25(3,4)15-19(20)13-23(24)27(21,7)8/h17-24H,11-16H2,1-10H3 |
| InChIKey | LZKORVDXYTYKKP-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |