C10H17Se — CID 136897890
CID 136897890 (PubChem CID 136897890) has the molecular formula C10H17Se and a molecular weight of 216.21 g/mol.
| Compound Name | CID 136897890 |
|---|---|
| PubChem CID | 136897890 |
| Molecular Formula | C10H17Se |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2[C@@H](C[C@H]1[Se])C2(C)C |
| InChI | InChI=1S/C10H17Se/c1-6-4-7-8(5-9(6)11)10(7,2)3/h6-9H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | ZZRKHOWOQDGFLD-BZNPZCIMSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|