C13H19N — CID 57226707
3-[(3S,4S,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]prop-2-enenitrile (PubChem CID 57226707) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-[(3S,4S,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]prop-2-enenitrile.
| Compound Name | 3-[(3S,4S,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 57226707 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-[(3S,4S,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]prop-2-enenitrile |
| SMILES | C[C@H]1C[C@@H]2C(C[C@@H]1C=CC#N)C2(C)C |
| InChI | InChI=1S/C13H19N/c1-9-7-11-12(13(11,2)3)8-10(9)5-4-6-14/h4-5,9-12H,7-8H2,1-3H3/t9-,10-,11+,12?/m0/s1 |
| InChIKey | RCAHNKBVXSNLBI-WSMDXJOWSA-N |
| XLogP | 3.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|