C9H12ClNO2 — CID 175434398
3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride (PubChem CID 175434398) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride.
| Compound Name | 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 175434398 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride |
| SMILES | CC1(C)C(/C=C\C#N)C1C(=O)O.Cl |
| InChI | InChI=1S/C9H11NO2.ClH/c1-9(2)6(4-3-5-10)7(9)8(11)12;/h3-4,6-7H,1-2H3,(H,11,12);1H/b4-3-; |
| InChIKey | IOIKFVNTAQLLHN-LNKPDPKZSA-N |
| XLogP | 1.84 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|