About 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride
3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride (PubChem CID 175434398) has the molecular formula C9H12ClNO2
and a molecular weight of 201.65 g/mol. Its IUPAC name is 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride |
| PubChem CID | 175434398 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride |
| SMILES | CC1(C)C(/C=C\C#N)C1C(=O)O.Cl |
| InChI | InChI=1S/C9H11NO2.ClH/c1-9(2)6(4-3-5-10)7(9)8(11)12;/h3-4,6-7H,1-2H3,(H,11,12);1H/b4-3-; |
| InChIKey | IOIKFVNTAQLLHN-LNKPDPKZSA-N |
| XLogP | 1.84 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride?
The IUPAC name of 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride (CID 175434398) is 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride.
What is the SMILES notation for 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride?
The canonical SMILES for 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride is CC1(C)C(/C=C\C#N)C1C(=O)O.Cl.
What is the InChIKey of 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride?
The InChIKey is IOIKFVNTAQLLHN-LNKPDPKZSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-9(2)6(4-3-5-10)7(9)8(11)12;/h3-4,6-7H,1-2H3,(H,11,12);1H/b4-3-;.
What are the key properties of 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride?
3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride is sourced from PubChem (CID 175434398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).