C12H17NO2 — CID 71074930
3-(2-cyanopent-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 71074930) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(2-cyanopent-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-(2-cyanopent-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 71074930 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(2-cyanopent-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCCC(C#N)=CC1C(C(=O)O)C1(C)C |
| InChI | InChI=1S/C12H17NO2/c1-4-5-8(7-13)6-9-10(11(14)15)12(9,2)3/h6,9-10H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | LCDNOZQBONZLCW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|