C17H27NO2 — CID 71075217
3-[(Z)-2-cyano-4-ethyloct-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 71075217) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[(Z)-2-cyano-4-ethyloct-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[(Z)-2-cyano-4-ethyloct-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 71075217 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3-[(Z)-2-cyano-4-ethyloct-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCCCC(CC)C/C(C#N)=C/C1C(C(=O)O)C1(C)C |
| InChI | InChI=1S/C17H27NO2/c1-5-7-8-12(6-2)9-13(11-18)10-14-15(16(19)20)17(14,3)4/h10,12,14-15H,5-9H2,1-4H3,(H,19,20)/b13-10- |
| InChIKey | GKYTXXNAZDMYBM-RAXLEYEMSA-N |
| XLogP | 4.40 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|