C16H24O9 — CID 175483952
2-(2-ethylhexyl)oxolane-2,3,4,5-tetracarboxylic acid (PubChem CID 175483952) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-(2-ethylhexyl)oxolane-2,3,4,5-tetracarboxylic acid.
| Compound Name | 2-(2-ethylhexyl)oxolane-2,3,4,5-tetracarboxylic acid |
|---|---|
| PubChem CID | 175483952 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-(2-ethylhexyl)oxolane-2,3,4,5-tetracarboxylic acid |
| SMILES | CCCCC(CC)CC1(C(=O)O)OC(C(=O)O)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C16H24O9/c1-3-5-6-8(4-2)7-16(15(23)24)10(13(19)20)9(12(17)18)11(25-16)14(21)22/h8-11H,3-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | CYAJUDAWCOGOQZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |