C12H15NO2 — CID 123803802
cis-(1R,3R)-3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 123803802) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is cis-(1R,3R)-3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 123803802 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | cis-(1R,3R)-3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC=CC(C#N)=C[C@@H]1[C@@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C12H15NO2/c1-4-5-8(7-13)6-9-10(11(14)15)12(9,2)3/h4-6,9-10H,1-3H3,(H,14,15)/t9-,10+/m1/s1 |
| InChIKey | QPPMMFHHAYTWNF-ZJUUUORDSA-N |
| XLogP | 2.37 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|