C15H14ClNO2 — CID 70529955
3-[(Z)-2-(2-chlorophenyl)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 70529955) has the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. Its IUPAC name is 3-[(Z)-2-(2-chlorophenyl)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[(Z)-2-(2-chlorophenyl)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70529955 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-[(Z)-2-(2-chlorophenyl)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(/C=C(\C#N)c2ccccc2Cl)C1C(=O)O |
| InChI | InChI=1S/C15H14ClNO2/c1-15(2)11(13(15)14(18)19)7-9(8-17)10-5-3-4-6-12(10)16/h3-7,11,13H,1-2H3,(H,18,19)/b9-7+ |
| InChIKey | UVGBYHSUBUCJQL-VQHVLOKHSA-N |
| XLogP | 3.60 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|