C15H28O2 — CID 102104759
(3S,4S)-3-(diethoxymethyl)-4,7,7-trimethylbicyclo[4.1.0]heptane (PubChem CID 102104759) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3S,4S)-3-(diethoxymethyl)-4,7,7-trimethylbicyclo[4.1.0]heptane.
| Compound Name | (3S,4S)-3-(diethoxymethyl)-4,7,7-trimethylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 102104759 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3S,4S)-3-(diethoxymethyl)-4,7,7-trimethylbicyclo[4.1.0]heptane |
| SMILES | CCOC(OCC)[C@H]1CC2C(C[C@@H]1C)C2(C)C |
| InChI | InChI=1S/C15H28O2/c1-6-16-14(17-7-2)11-9-13-12(8-10(11)3)15(13,4)5/h10-14H,6-9H2,1-5H3/t10-,11-,12?,13?/m0/s1 |
| InChIKey | OGXYRVUNUWIHDZ-ZSVAQUKISA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|