C26H44 — CID 21334697
2,2,3,3,6,6,11,11-octamethyl-1,4,4a,5,5a,6a,7,10,10a,11a,12,12a-dodecahydrotetracene (PubChem CID 21334697) has the molecular formula C26H44 and a molecular weight of 356.64 g/mol. Its IUPAC name is 2,2,3,3,6,6,11,11-octamethyl-1,4,4a,5,5a,6a,7,10,10a,11a,12,12a-dodecahydrotetracene.
| Compound Name | 2,2,3,3,6,6,11,11-octamethyl-1,4,4a,5,5a,6a,7,10,10a,11a,12,12a-dodecahydrotetracene |
|---|---|
| PubChem CID | 21334697 |
| Molecular Formula | C26H44 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | 2,2,3,3,6,6,11,11-octamethyl-1,4,4a,5,5a,6a,7,10,10a,11a,12,12a-dodecahydrotetracene |
| SMILES | CC1(C)C2CC=CCC2C(C)(C)C2CC3CC(C)(C)C(C)(C)CC3CC21 |
| InChI | InChI=1S/C26H44/c1-23(2)15-17-13-21-22(14-18(17)16-24(23,3)4)26(7,8)20-12-10-9-11-19(20)25(21,5)6/h9-10,17-22H,11-16H2,1-8H3 |
| InChIKey | KMOXBYRDNPQDDI-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|