About (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane
(1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane (PubChem CID 163487184) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane.
Analyze (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane?
The IUPAC name of (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane (CID 163487184) is (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane.
What is the SMILES notation for (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane?
The canonical SMILES for (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane is C[C@@H]1C2C[C@H]2[C@H]2C[C@@]12C.
What is the InChIKey of (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane?
The InChIKey is CJNYZIMVCHTKSL-DUULYHEGSA-N. The full InChI is InChI=1S/C9H14/c1-5-6-3-7(6)8-4-9(5,8)2/h5-8H,3-4H2,1-2H3/t5-,6?,7-,8-,9+/m1/s1.
What are the key properties of (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane?
(1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane has a molecular weight of 122.21 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R,4S,5R)-4,5-dimethyltricyclo[4.1.0.02,4]heptane is sourced from PubChem (CID 163487184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).