About 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid
5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid (PubChem CID 163848454) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid.
Analyze 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid?
The IUPAC name of 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid (CID 163848454) is 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid.
What is the SMILES notation for 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid?
The canonical SMILES for 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid is CC1C2CC1(C)C(C)C1CC21C(=O)O.
What is the InChIKey of 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid?
The InChIKey is OSFXAQZMHDVCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-6-8-4-11(6,3)7(2)9-5-12(8,9)10(13)14/h6-9H,4-5H2,1-3H3,(H,13,14).
What are the key properties of 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid?
5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid has a molecular weight of 194.27 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7-trimethyltricyclo[4.1.1.02,4]octane-2-carboxylic acid is sourced from PubChem (CID 163848454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).