C15H22O4 — CID 54093451
4,5,8-trimethyladamantane-1,2-dicarboxylic acid (PubChem CID 54093451) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4,5,8-trimethyladamantane-1,2-dicarboxylic acid.
| Compound Name | 4,5,8-trimethyladamantane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 54093451 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4,5,8-trimethyladamantane-1,2-dicarboxylic acid |
| SMILES | CC1C2CC3CC1(C)CC(C(=O)O)(C3C)C2C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-7-9-4-10-8(2)14(3,5-9)6-15(7,13(18)19)11(10)12(16)17/h7-11H,4-6H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | MVLUHULOGZLJJC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |