4,5,8-trimethyladamantane-1,2-dicarboxylic acid

C15H22O4 — CID 54093451

IUPAC4,5,8-trimethyladamantane-1,2-dicarboxylic acid
SMILESCC1C2CC3CC1(C)CC(C(=O)O)(C3C)C2C(=O)O
InChIInChI=1S/C15H22O4/c1-7-9-4-10-8(2)14(3,5-9)6-15(7,13(18)19)11(10)12(16)17/h7-11H,4-6H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyMVLUHULOGZLJJC-UHFFFAOYSA-N
MW266.34 g/mol
LogP2.48
Rot. Bonds2

About 4,5,8-trimethyladamantane-1,2-dicarboxylic acid

4,5,8-trimethyladamantane-1,2-dicarboxylic acid (PubChem CID 54093451) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4,5,8-trimethyladamantane-1,2-dicarboxylic acid.

Molecular Properties

Compound Name4,5,8-trimethyladamantane-1,2-dicarboxylic acid
PubChem CID54093451
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Name4,5,8-trimethyladamantane-1,2-dicarboxylic acid
SMILESCC1C2CC3CC1(C)CC(C(=O)O)(C3C)C2C(=O)O
InChIInChI=1S/C15H22O4/c1-7-9-4-10-8(2)14(3,5-9)6-15(7,13(18)19)11(10)12(16)17/h7-11H,4-6H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyMVLUHULOGZLJJC-UHFFFAOYSA-N
XLogP2.48
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 52.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4,5,8-trimethyladamantane-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5,8-trimethyladamantane-1,2-dicarboxylic acid?
The IUPAC name of 4,5,8-trimethyladamantane-1,2-dicarboxylic acid (CID 54093451) is 4,5,8-trimethyladamantane-1,2-dicarboxylic acid.
What is the SMILES notation for 4,5,8-trimethyladamantane-1,2-dicarboxylic acid?
The canonical SMILES for 4,5,8-trimethyladamantane-1,2-dicarboxylic acid is CC1C2CC3CC1(C)CC(C(=O)O)(C3C)C2C(=O)O.
What is the InChIKey of 4,5,8-trimethyladamantane-1,2-dicarboxylic acid?
The InChIKey is MVLUHULOGZLJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-7-9-4-10-8(2)14(3,5-9)6-15(7,13(18)19)11(10)12(16)17/h7-11H,4-6H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 4,5,8-trimethyladamantane-1,2-dicarboxylic acid?
4,5,8-trimethyladamantane-1,2-dicarboxylic acid has a molecular weight of 266.34 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,8-trimethyladamantane-1,2-dicarboxylic acid is sourced from PubChem (CID 54093451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).