C19H34 — CID 160997300
4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;methane (PubChem CID 160997300) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is 4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;methane.
| Compound Name | 4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;methane |
|---|---|
| PubChem CID | 160997300 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;methane |
| SMILES | C.CC1C(C)C2CC1C1C2C2CC1C(C)(C)C2(C)C |
| InChI | InChI=1S/C18H30.CH4/c1-9-10(2)12-7-11(9)15-13-8-14(16(12)15)18(5,6)17(13,3)4;/h9-16H,7-8H2,1-6H3;1H4 |
| InChIKey | TVKLXFUXKPXENM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|