C22H38O — CID 59872456
4-(2-methoxy-2-methylpropyl)-4,5,5,9,10-pentamethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 59872456) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is 4-(2-methoxy-2-methylpropyl)-4,5,5,9,10-pentamethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4-(2-methoxy-2-methylpropyl)-4,5,5,9,10-pentamethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 59872456 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 4-(2-methoxy-2-methylpropyl)-4,5,5,9,10-pentamethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | COC(C)(C)CC1(C)C2CC(C3C4CC(C(C)C4C)C32)C1(C)C |
| InChI | InChI=1S/C22H38O/c1-12-13(2)15-9-14(12)18-16-10-17(19(15)18)22(7,21(16,5)6)11-20(3,4)23-8/h12-19H,9-11H2,1-8H3 |
| InChIKey | BUCBCOQJALLTMV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|