C24H35F7O3 — CID 59986132
4-fluoro-5,5,9,10-tetramethyl-4-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 59986132) has the molecular formula C24H35F7O3 and a molecular weight of 504.53 g/mol. Its IUPAC name is 4-fluoro-5,5,9,10-tetramethyl-4-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4-fluoro-5,5,9,10-tetramethyl-4-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 59986132 |
| Molecular Formula | C24H35F7O3 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-fluoro-5,5,9,10-tetramethyl-4-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | COCCOCOC(CC1(F)C2CC(C3C4CC(C(C)C4C)C32)C1(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H35F7O3/c1-12-13(2)15-8-14(12)18-16-9-17(19(15)18)21(25,20(16,3)4)10-22(23(26,27)28,24(29,30)31)34-11-33-7-6-32-5/h12-19H,6-11H2,1-5H3 |
| InChIKey | LOBNTZYLMPFHLT-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|