C36H62 — CID 159252719
4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;3,8,8,9,9-pentamethyl-5-propyltricyclo[5.2.1.02,6]decane (PubChem CID 159252719) has the molecular formula C36H62 and a molecular weight of 494.89 g/mol. Its IUPAC name is 4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;3,8,8,9,9-pentamethyl-5-propyltricyclo[5.2.1.02,6]decane.
| Compound Name | 4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;3,8,8,9,9-pentamethyl-5-propyltricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 159252719 |
| Molecular Formula | C36H62 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.49 |
| IUPAC Name | 4,4,5,5,9,10-hexamethyltetracyclo[6.2.1.13,6.02,7]dodecane;3,8,8,9,9-pentamethyl-5-propyltricyclo[5.2.1.02,6]decane |
| SMILES | CC1C(C)C2CC1C1C2C2CC1C(C)(C)C2(C)C.CCCC1CC(C)C2C1C1CC2C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H30.C18H32/c1-9-10(2)12-7-11(9)15-13-8-14(16(12)15)18(5,6)17(13,3)4;1-7-8-12-9-11(2)15-13-10-14(16(12)15)18(5,6)17(13,3)4/h9-16H,7-8H2,1-6H3;11-16H,7-10H2,1-6H3 |
| InChIKey | KVMUQJQHSAAYBU-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|