About 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid
3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid (PubChem CID 20622006) has the molecular formula C16H24O4
and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid.
Analyze 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid?
The IUPAC name of 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid (CID 20622006) is 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid.
What is the SMILES notation for 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid?
The canonical SMILES for 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid is CCCC1CC(C)C2C3CC(C(C(=O)O)C3C(=O)O)C12.
What is the InChIKey of 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid?
The InChIKey is FFKDKRHMOOETRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4/c1-3-4-8-5-7(2)11-9-6-10(12(8)11)14(16(19)20)13(9)15(17)18/h7-14H,3-6H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid?
3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid has a molecular weight of 280.36 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-propyltricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid is sourced from PubChem (CID 20622006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).