C11H18 — CID 123992572
6-ethyl-8-methyltricyclo[3.3.0.02,4]octane (PubChem CID 123992572) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 6-ethyl-8-methyltricyclo[3.3.0.02,4]octane.
| Compound Name | 6-ethyl-8-methyltricyclo[3.3.0.02,4]octane |
|---|---|
| PubChem CID | 123992572 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 6-ethyl-8-methyltricyclo[3.3.0.02,4]octane |
| SMILES | CCC1CC(C)C2C3CC3C12 |
| InChI | InChI=1S/C11H18/c1-3-7-4-6(2)10-8-5-9(8)11(7)10/h6-11H,3-5H2,1-2H3 |
| InChIKey | GXUBHDPZNCORIJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |